| Name |
5,7,3',5'-Tetrahydroxy-3,6,4'-trimethoxyflavone |
| Formula |
C18H16O9 |
| Mw |
376.07943211 |
| CAS RN |
71325-91-2 |
| C_ID |
C00004823
, 
|
| InChIKey |
FPFLMCPZDZURSF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O9/c1-24-16-8(19)4-7(5-9(16)20)15-18(26-3)14(23)12-11(27-15)6-10(21)17(25-2)13(12)22/h4-6,19-22H,1-3H3 |
| SMILES |
COc1c(O)cc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia grandis | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Didiereaceae | Alluaudia ascendens | Ref. |
| Plantae | Didiereaceae | Decaryia madagascariensis | Ref. |
|
|
zoom in
| Organism | Alluaudia ascendens |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Rabesa,Phytochem.,18,(1979),360 |
|---|
|
