| Name |
Limocitrol |
| Formula |
C18H16O9 |
| Mw |
376.07943211 |
| CAS RN |
549-10-0 |
| C_ID |
C00004792
, 
|
| InChIKey |
LCKHNFJHVWUHTR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O9/c1-24-9-6-7(4-5-8(9)19)15-13(22)11(20)10-12(21)17(25-2)14(23)18(26-3)16(10)27-15/h4-6,19,21-23H,1-3H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
| Organism | Primula officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Horowitz,J.Org.Chem.,25,(1960),2183 |
|---|
|