| Name |
Gossypetin 3,8,3',4'-tetramethyl ether |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
42923-42-2 |
| C_ID |
C00004740
, 
|
| InChIKey |
MBOJUFZHGKKHLS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-12-6-5-9(7-13(12)24-2)16-19(26-4)15(22)14-10(20)8-11(21)17(25-3)18(14)27-16/h5-8,20-21H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Heteromma simplicifolium | Ref. |
| Plantae | Asteraceae | Parastrephia quadrangularis | Ref. |
| Plantae | Asteraceae | Psiadia trinervia | Ref. |
| Plantae | Cistaceae | Cistus parviflorus | Ref. |
| Plantae | Zygophyllaceae | Fagonia bruguieri  | Ref. |
|
|
zoom in
| Organism | Psiadia trinervia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Loyola,Phytochem.,24,(1985),1871 |
|---|
|