| Name |
Gossypetin 3,7,8-trimethyl ether 5,3',4'-Trihydroxy-3,7,8-trimethoxyflavone 3,7,8-Trimethylgossypetin 2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
4693-88-3 |
| C_ID |
C00004733
, 
|
| InChIKey |
KADCZAAXTVHSJI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-12-7-11(21)13-14(22)18(25-3)15(26-17(13)16(12)24-2)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calycadenia ciliosa | Ref. |
| Plantae | Asteraceae | Calycadenia multiglandulosa | Ref. |
| Plantae | Asteraceae | Hemizonia spp. | Ref. |
| Plantae | Asteraceae | Madia anomala | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Calceolariaceae | Calceolaria tenella | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos muricatus | Ref. |
| Plantae | Labiatae | Cyanostegia angustifolia | Ref. |
|
|
zoom in
| Organism | Hemizonia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Tetrahydron,21,(1965),3219 |
|---|
|