| Name |
Corniculatusin |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
27500-34-1 |
| C_ID |
C00004724
, 
|
| InChIKey |
ZASFHSAGASJGRN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-15-10(20)5-9(19)11-12(21)13(22)14(24-16(11)15)6-2-3-7(17)8(18)4-6/h2-5,17-20,22H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Prosopidastrum globosum | Ref. |
| Plantae | Rosaceae | Dryas octopetala  | Ref. |
| - | - | Humata pectinata | Ref. |
|
|
zoom in
| Organism | Dryas octopetala | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Nielsen,Tetrahedron Lett.,(1970),803 |
|---|
|