| Name |
Laciniatin 3,5,7-Trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
74161-28-7 |
| C_ID |
C00004690
, 
|
| InChIKey |
MBAMSENKVRMPKA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-10-4-3-7(5-8(10)18)16-15(22)13(20)12-11(25-16)6-9(19)17(24-2)14(12)21/h3-6,18-19,21-22H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica chamissonis | Ref. |
| Plantae | Asteraceae | Arnica montana  | Ref. |
| Plantae | Asteraceae | Brickellia laciniata | Ref. |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
|
|
zoom in
| Organism | Brickellia laciniata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Timmermann,Phyotchem.,18,(1979),1855 |
|---|
|