| Name |
Eupatoletin Eupatolitin 3,3',4',5-tetrahydroxy-6,7-dimethoxyflavone 2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
29536-44-5 |
| C_ID |
C00004688
, 
|
| InChIKey |
WYKWHSPRHPZRCR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-11-6-10-12(14(21)17(11)24-2)13(20)15(22)16(25-10)7-3-4-8(18)9(19)5-7/h3-6,18-19,21-22H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Brickellia glutinosa | Ref. |
| Plantae | Asteraceae | Chromolaena meridensis | Ref. |
| Plantae | Asteraceae | Decachaeta haenkeana | Ref. |
| Plantae | Asteraceae | Eupatorium ligustrinum | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Pulicaria gnaphaloides  | Ref. |
| Plantae | Asteraceae | Rudbeckia hirta | Ref. |
| Plantae | Polemoniaceae | Ipomopsis aggregata | Ref. |
|
|
zoom in
| Organism | Chromolaena meridensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Quijano,Tetrahedron,26,(1970),2851 |
|---|
|