| Name |
Quercetin 5,3'-dimethyl ether 3,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
40554-94-7 |
| C_ID |
C00004641
, 
|
| InChIKey |
NKJWZTPASPJYBA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-11-5-8(3-4-10(11)19)17-16(21)15(20)14-12(23-2)6-9(18)7-13(14)24-17/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(OC)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Cistaceae | Cistus laurifolius  | Ref. |
| Plantae | Fabaceae | Medicago x varia | Ref. |
|
|
zoom in
| Organism | Medicago x varia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Gehring,Z.Naturforsch.C.,35,(1980),380 |
|---|
|