| Name |
Caryatin 3,5-Di-O-Methylquercetin 2-(3,4-Dihydroxyphenyl)-7-hydroxy-3,5-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
1486-66-4 |
| C_ID |
C00004637
, 
|
| InChIKey |
AOFQCVDYMNHCKD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-12-6-9(18)7-13-14(12)15(21)17(23-2)16(24-13)8-3-4-10(19)11(20)5-8/h3-7,18-20H,1-2H3 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(OC)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cunoniaceae | Eucryphia cordifolia | Ref. |
| Plantae | Cunoniaceae | Eucryphia glutinosa | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Juglandaceae | Carya pecan | Ref. |
| - | - | Carya | Ref. |
|
|
zoom in
| Organism | Dioscorea bulbifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|