| Name |
3,5-Dihydroxy-6,7,8-trimethoxyflavone 3,5-Dihydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
14221-65-9 |
| C_ID |
C00004588
, 
|
| InChIKey |
TYZXGIOTNSBKDB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-16-12(20)10-11(19)13(21)14(9-7-5-4-6-8-9)25-15(10)17(23-2)18(16)24-3/h4-8,20-21H,1-3H3 |
| SMILES |
COc1c(OC)c(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea nobilis  | Ref. |
| Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
| Plantae | Asteraceae | Achyrocline spp. | Ref. |
| Plantae | Asteraceae | Artemisia klotzchiana | Ref. |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Gnaphalium chilense | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Asteraceae | Helichrysum graveolen | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
|
|
zoom in
| Organism | Achyrocline spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Hanse.,Tetrahedron Lett.,(1967),735 |
|---|
|