| Name |
Araneol 5,7-Dihydroxy-3,6,8-trimethoxyflavone 5,7-Dihydroxy-3,6,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
71479-92-0 |
| C_ID |
C00004587
, 
|
| InChIKey |
IAAZHANNYDYGRX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-16-11(19)10-12(20)17(23-2)14(9-7-5-4-6-8-9)25-15(10)18(24-3)13(16)21/h4-8,19,21H,1-3H3 |
| SMILES |
COc1c(O)c(OC)c2oc(-c3ccccc3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anaphalis araneosa | Ref. |
| Plantae | Asteraceae | Anaphalis margaritacea | Ref. |
| Plantae | Asteraceae | Gnaphalium elegans | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Asteraceae | Helichrysum decumbens | Ref. |
|
|
zoom in
| Organism | Gnaphalium elegans | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Torrenegra,Phytochem.,19,(1980),2795 |
|---|
|