| Name |
Kaempferol 3,5-dimethyl ether 7,4'-Dihydroxy-3,5-dimethoxyflavone 7-Hydroxy-2-(4-hydroxyphenyl)-3,5-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
1486-65-3 |
| C_ID |
C00004568
, 
|
| InChIKey |
XMCNEMKKAQGVGK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-12-7-11(19)8-13-14(12)15(20)17(22-2)16(23-13)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1c(-c2ccc(O)cc2)oc2cc(O)cc(OC)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysothamnus humilis | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Plantaginaceae | Linaria dalmatica | Ref. |
|
|
zoom in
| Organism | Linaria dalmatica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kapoor,Fitoterapia,56,(1985),296 |
|---|
|