| Name |
5,7-Dihydroxy-3,6-dimethoxyflavone 3-O-Methylalnusin Alnusin 3-methyl ether 5,7-Dihydroxy-3,6-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
59917-40-7 |
| C_ID |
C00004544
, 
|
| InChIKey |
RVOWLPGDGHUGHV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-16-10(18)8-11-12(13(16)19)14(20)17(22-2)15(23-11)9-6-4-3-5-7-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccccc3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Gomphrena boliviana | Ref. |
| Plantae | Amaranthaceae | Gomphrena martiana | Ref. |
| Plantae | Asteraceae | Anaphalis margaritacea | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Pseudognaphalium cheiranthifolium | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Anaphalis margaritacea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Buschi,Phytochem.,19,(1980),903 |
|---|
|