| Name |
8-Hydroxyluteolin 4'-methyl ether 7-(6'''-acetylallosyl)(1->2)(6''-acetylglucoside) |
| Formula |
C32H36O19 |
| Mw |
724.18507897 |
| CAS RN |
108706-09-8 |
| C_ID |
C00004521
, 
|
| InChIKey |
ZXQCHXLLIKMUTB-VSZLIDMYNA-N |
| InChICode |
InChI=1S/C32H36O19/c1-11(33)45-9-20-23(38)26(41)28(43)31(49-20)51-30-27(42)24(39)21(10-46-12(2)34)50-32(30)48-19-8-16(37)22-15(36)7-18(47-29(22)25(19)40)13-4-5-17(44-3)14(35)6-13/h4-8,20-21,23-24,26-28,30-32,35,37-43H,9-10H2,1-3H3/t20-,21+,23+,24+,26+,27+,28+,30-,31+,32-/m1/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(COC(C)=O)[C@@H](O)[C@H](O)C4O[C@@H]4OC(COC(C)=O)[C@@H](O)[C@H](O)C4O)c(O)c3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Sideritis scardica  | Ref. |
| Plantae | Labiatae | Sideritis syriaca | Ref. |
| Plantae | Plantaginaceae | Gratiola officinalis  | Ref. |
|
|
zoom in
| Organism | Gratiola officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Abdel Sattar,Fitoterapia,64,(1993),278 |
|---|
|