| Name |
Tricin 7-rutinoside |
| Formula |
C29H34O16 |
| Mw |
638.18468504 |
| CAS RN |
50816-55-2 |
| C_ID |
C00004466
, 
|
| InChIKey |
XQKBGHNKHIYCQA-ZIENZEOKNA-N |
| InChICode |
InChI=1S/C29H34O16/c1-10-21(32)24(35)26(37)28(42-10)41-9-19-23(34)25(36)27(38)29(45-19)43-12-6-13(30)20-14(31)8-15(44-16(20)7-12)11-4-17(39-2)22(33)18(5-11)40-3/h4-8,10,19,21,23-30,32-38H,9H2,1-3H3/t10-,19-,21+,23-,24+,25+,26-,27-,28-,29-/m1/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)[C@@H](O)[C@H](O)C4O)cc3o2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Palmae | Phoenix rupicola | Ref. |
| Plantae | Palmae | Phoenix tomentosa | Ref. |
| Plantae | Palmae | Rhopaloblaste singaporensis | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
|
|
zoom in
| Organism | Rhopaloblaste singaporensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Williams,Phytochem.,12,(1973),2417 |
|---|
|