| Name |
8-Hydroxyluteolin 8-glucoside Hypolaetin 8-O-beta-D-glucoside Hypolaetin-8-O-beta-D-glucoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
27686-36-8 |
| C_ID |
C00004419
, 
|
| InChIKey |
LQSNPVIQIPKOGP-CUTYNBGFNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-14-16(28)17(29)18(30)21(32-14)33-19-12(27)4-10(25)15-11(26)5-13(31-20(15)19)7-1-2-8(23)9(24)3-7/h1-5,14,16-18,21-25,27-30H,6H2/t14-,16-,17+,18-,21+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Labiatae | Sideritis javalambrensis | Ref. |
| Plantae | Labiatae | Sideritis mugronensis | Ref. |
|
|
zoom in
| Organism | Sideritis mugronensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Villar,Planta Med.,45,(1985),70 |
|---|
|