| Name |
6-Hydroxyluteolin 7-glucoside 6-Hydroxyluteolin 7-O-beta-glucopyranoside:6-Hydroxyluteolin 7-glucoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
54300-65-1 |
| C_ID |
C00004386
, 
|
| InChIKey |
HYPKUHLLPBGDLF-NFBJXHJONA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-14-17(27)19(29)20(30)21(33-14)32-13-5-12-15(18(28)16(13)26)10(25)4-11(31-12)7-1-2-8(23)9(24)3-7/h1-5,14,17,19-24,26-30H,6H2/t14-,17-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Catalpa bignonioides | Ref. |
| Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
| Plantae | Iridaceae | Crocus chrysanthus | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Jubulaceae | Frullania dilatata | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Thymus loscosii | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper L.  | Ref. |
|
|
zoom in
| Organism | Crocus chrysanthus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Harborne,Phytochem.,6,(1967),1643
Williams,Phytochem.,25,(1986),2135 |
|---|
|