| Name |
Luteolin 7-galactoside-4'-glucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
|
| C_ID |
C00004295
, 
|
| InChIKey |
CFVDPAXOTMTQCU-XHYJUMRUNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-17-20(33)22(35)24(37)26(42-17)39-10-4-12(31)19-13(32)6-15(40-16(19)5-10)9-1-2-14(11(30)3-9)41-27-25(38)23(36)21(34)18(8-29)43-27/h1-6,17-18,20-31,33-38H,7-8H2/t17-,18+,20-,21+,22+,23-,24+,25+,26+,27+/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(O)c2)oc2cc(O[C@@H]3O[C@@H](CO)[C@H](O)C(O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Vernonia baldwinii | Ref. |
| Plantae | Asteraceae | Vernonia greggii | Ref. |
| Plantae | Asteraceae | Vernonia texana | Ref. |
|
|
zoom in
| Organism | Vernonia texana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Mabry,Biochem.Syst.Ecol.,2,(1975),185 |
|---|
|