| Name |
Luteolin 3',7-di-O-beta-glucoside Luteolin 7,3'-diglucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
52187-80-1 |
| C_ID |
C00004290
, 
|
| InChIKey |
BISZYPSIZGKOFA-WIFMXYSFNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-17-20(33)22(35)24(37)26(42-17)39-10-4-12(31)19-13(32)6-14(40-16(19)5-10)9-1-2-11(30)15(3-9)41-27-25(38)23(36)21(34)18(8-29)43-27/h1-6,17-18,20-31,33-38H,7-8H2/t17-,18-,20-,21-,22+,23+,24+,25-,26-,27-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Launaea nudicaulis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Resedaceae | Reseda luteola  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Reseda luteola | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Geiger,Naturforsch.,28,(1973),773
Mansour,Phytochem.,22,(1983),2630 |
|---|
|