| Name |
Pectolinarin |
| Formula |
C29H34O15 |
| Mw |
622.18977042 |
| CAS RN |
28978-02-1 |
| C_ID |
C00004240
, 
|
| InChIKey |
DUXQKCCELUKXOE-BATVZXCDNA-N |
| InChICode |
InChI=1S/C29H34O15/c1-11-20(31)23(34)25(36)28(41-11)40-10-18-21(32)24(35)26(37)29(44-18)43-17-9-16-19(22(33)27(17)39-3)14(30)8-15(42-16)12-4-6-13(38-2)7-5-12/h4-9,11,18,20-21,23-26,28-29,31-37H,10H2,1-3H3/t11-,18-,20-,21+,23-,24-,25+,26-,28+,29+/m0/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)[C@@H](O)[C@H](O)C4O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Teucridium parvifolium | Ref. |
| Plantae | Plantaginaceae | Kickxia ramosissima | Ref. |
| Plantae | Plantaginaceae | Linaria vulgaris  | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
|
|
zoom in
| Organism | Linaria vulgaris | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Merz,Arch.Pharm.(Weinheim),274,(1963),126 |
|---|
|