| Name |
Aequinetin |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
31025-53-3 |
| C_ID |
C00004110
, 
|
| InChIKey |
PIJHQWMTZXDYER-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)28-11-6-12(23)17-13(24)8-14(29-15(17)7-11)10-4-2-1-3-5-10/h1-8,16,18-23,25-27H,9H2/t16-,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cytisus baeticus | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Rosaceae | Prunus aequinoctialis | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
|
|
zoom in
| Organism | Prunus aequinoctialis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Hasegawa,J.Am.Chem.Soc.,79,(1957),1738 |
|---|
|