| Name |
Toringin |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
1329-10-8 |
| C_ID |
C00004109
, 
|
| InChIKey |
IRHAYEHCEVRWSB-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)29-15-7-11(23)6-14-17(15)12(24)8-13(28-14)10-4-2-1-3-5-10/h1-8,16,18-23,25-27H,9H2/t16-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rosaceae | Docyniopsis tschonoski | Ref. |
| Plantae | Rosaceae | Docyniopsis tschonoskii | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Docyniopsis tschonoskii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Hirose,J.Pharm.Soc.Jpn,29,(1909)1 |
|---|
|