| Name |
6-Prenylapigenin 6-C-Prenylapigenin 5,7,4'-Trihydroxy-6-prenylflavone 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
68097-13-2 |
| C_ID |
C00004089
, 
|
| InChIKey |
VJDRSTHNWHVTNQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-11(2)3-8-14-15(22)9-18-19(20(14)24)16(23)10-17(25-18)12-4-6-13(21)7-5-12/h3-7,9-10,21-22,24H,8H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Cannabis sativa L.  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Dorstenia ciliata | Ref. |
| Plantae | Moraceae | Dorstenia kameruniana | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
|
|
zoom in
| Organism | Garcinia xanthochymus | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|