| Name |
Kuwanon T 2-[2,4-Dihydroxy-3-(3-methyl-2-butenyl)phenyl]-5,7-dihydroxy-3-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
100187-66-4 |
| C_ID |
C00004030
, 
|
| InChIKey |
KATQHJZHAFCFAQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-7-16-19(27)10-9-17(23(16)29)25-18(8-6-14(3)4)24(30)22-20(28)11-15(26)12-21(22)31-25/h5-6,9-12,26-29H,7-8H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)ccc(-c2oc3cc(O)cc(O)c3c(=O)c2CC=C(C)C)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus lhou | Ref. |
|
|
zoom in
| Organism | Morus lhou | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fukai,Chem.Pharm.Bull,33,(1985),4288 |
|---|
|