| Name |
Mulberrin Kuwanon C Norartocarpin 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
62949-79-5 |
| C_ID |
C00004028
, 
|
| InChIKey |
UWQYBLOHTQWSQD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-8-17-20(28)12-21(29)22-23(30)18(9-6-14(3)4)24(31-25(17)22)16-10-7-15(26)11-19(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(-c2ccc(O)cc2O)oc2c(CC=C(C)C)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus fretessi | Ref. |
| Plantae | Moraceae | Artocarpus gomezianus Wallich ex Trecul  | Ref. |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Artocarpus heterophyllus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Venkataraman,Phytochem.,11,(1972),1571
Deshpande,Tetrahedron Lett.,(1968),1715 |
|---|
|