| Name |
Gancaonin Q |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
134958-52-4 |
| C_ID |
C00004017
, 
|
| InChIKey |
WGNIVAMNAWBYRO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)5-7-16-11-17(8-10-19(16)26)22-13-21(28)24-23(30-22)12-20(27)18(25(24)29)9-6-15(3)4/h5-6,8,10-13,26-27,29H,7,9H2,1-4H3 |
| SMILES |
CC(C)=CCc1cc(-c2cc(=O)c3c(O)c(CC=C(C)C)c(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Moraceae | Dorstenia angusticornis | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fukai,Phytochem.,30,(1991),1245 |
|---|
|