| Name |
Eucalyptin 4',7-Dimethoxy-6,8-dimethyl-5-hydroxyflavone 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6,8-dimethyl-4H-1-benzopyran-4-one |
| Formula |
C19H18O5 |
| Mw |
326.11542369 |
| CAS RN |
3122-88-1 |
| C_ID |
C00003991
, 
|
| InChIKey |
NHMMAMIRMITGRD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O5/c1-10-17(21)16-14(20)9-15(12-5-7-13(22-3)8-6-12)24-19(16)11(2)18(10)23-4/h5-9,21H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(C)c(OC)c(C)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Kalmia latifolia  | Ref. |
| Plantae | Myrtaceae | Angophora lanceolata | Ref. |
| Plantae | Myrtaceae | Angophora subvelutina | Ref. |
| Plantae | Myrtaceae | Callistemon lanceolatus | Ref. |
| Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
| Plantae | Myrtaceae | Eugenia biflora | Ref. |
| Plantae | Myrtaceae | Syncarpia glomulifera | Ref. |
|
|
zoom in
| Organism | Angophora subvelutina | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Hillis,Phytochem.,4,(1965),541
Courtney,Phytochem.,22,(1983),947 |
|---|
|