| Name |
5,7-Dihydroxy-8,3',4',5'-tetramethoxyflavone 3',4',5'-Trimethoxywogonin 5,7-Dihydroxy-8-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
32348-78-0 |
| C_ID |
C00003961
, 
|
| InChIKey |
ZMFBCRNURMVYEI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-14-5-9(6-15(24-2)18(14)26-4)13-8-11(21)16-10(20)7-12(22)17(25-3)19(16)27-13/h5-8,20,22H,1-4H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)c(OC)c3o2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Bracteantha viscosa | Ref. |
| Plantae | Rubiaceae | Gardenia gummifera  | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
|
|
zoom in
| Organism | Gardenia lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Gupta, Indian J.Chem.,13,(1975),785
Kumari,Fitoterapia,60,(1989),558 |
|---|
|