| Name |
Acerosin 3',5,7-Trihydroxy-4',6,8-trimethoxyflavone 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
15835-74-2 |
| C_ID |
C00003930
, 
|
| InChIKey |
BTMNGQCCCWTUQH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-11-5-4-8(6-9(11)19)12-7-10(20)13-14(21)17(24-2)15(22)18(25-3)16(13)26-12/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)c(OC)c3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calycadenia spp. | Ref. |
| Plantae | Asteraceae | Helianthus strumosus | Ref. |
| Plantae | Asteraceae | Iva acerosa | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Labiatae | Vitex negundo  | Ref. |
| Plantae | Rubiaceae | Gardenia spp.  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Iva acerosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Farkas,Tetrahedron,23,(1967),3557 |
|---|
|