| Name |
Tricetin 4'-methyl ether 2-(3,5-Dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
90745-22-5 |
| C_ID |
C00003914
, 
|
| InChIKey |
ONKNGUOZRAKQPG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-16-11(20)2-7(3-12(16)21)13-6-10(19)15-9(18)4-8(17)5-14(15)23-13/h2-6,17-18,20-21H,1H3 |
| SMILES |
COc1c(O)cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Nonea lutea | Ref. |
| Plantae | Boraginaceae | Nonea pulla | Ref. |
| Plantae | Passifloraceae | Passiflora palmeri | Ref. |
| Plantae | Plantaginaceae | Asarina procumbens | Ref. |
|
|
zoom in
| Organism | Passiflora palmeri | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Ulubelen,J.Nat.Prod.,47,(1984),384 |
|---|
|