| Name |
5-Hydroxy-6,7,3',4'-tetramethoxyflavone 6-Hydroxyluteolin 6,7,3',4'-tetramethyl ether 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
21763-80-4 |
| C_ID |
C00003898
, 
|
| InChIKey |
QEWSAPKRFOFQIU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea conferta | Ref. |
| Plantae | Asteraceae | Achillea santolina  | Ref. |
| Plantae | Asteraceae | Ageratina pichinchensis | Ref. |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Asteraceae | Artemisia austriaca | Ref. |
| Plantae | Asteraceae | Artemisia giraldii | Ref. |
| Plantae | Asteraceae | Artemisia mongolica | Ref. |
| Plantae | Asteraceae | Artemisia sieversiana  | Ref. |
| Plantae | Asteraceae | Artemisia verlotiorum | Ref. |
| Plantae | Asteraceae | Brickellia scoparia | Ref. |
| Plantae | Asteraceae | Centaurea granata | Ref. |
| Plantae | Asteraceae | Centaurea macrocephala | Ref. |
| Plantae | Asteraceae | Chromolaena arnottiana | Ref. |
| Plantae | Asteraceae | Eupatorium altissimum | Ref. |
| Plantae | Asteraceae | Eupatorium microphyllum | Ref. |
| Plantae | Asteraceae | Lagophylla glandulosa | Ref. |
| Plantae | Asteraceae | Parthenium incanum | Ref. |
| Plantae | Asteraceae | Tanacetum santolinioides | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Cunila incana | Ref. |
| Plantae | Labiatae | Isodon leucophyllus | Ref. |
| Plantae | Labiatae | Mentha longifolia  | Ref. |
| Plantae | Labiatae | Mentha piperita L.var.kubamskaya  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Ocimum americanum var. americanum  | Ref. |
| Plantae | Labiatae | Orthosiphon aristatus  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia dominica | Ref. |
| Plantae | Labiatae | Salvia macrosiphon | Ref. |
| Plantae | Labiatae | Salvia mirzayani | Ref. |
| Plantae | Labiatae | Salvia syriaca | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Sideritis angustifolia | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Teucrium alyssifolium | Ref. |
| Plantae | Labiatae | Teucrium botrys | Ref. |
| Plantae | Labiatae | Teucrium pseudochamaepitys | Ref. |
| Plantae | Labiatae | Ziziphora hispanica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus tangerina  | Ref. |
| Plantae | Rutaceae | Merrillia caloxylon | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
|
|
zoom in
| Organism | Ageratina pichinchensis | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|