| Name |
Desmethoxycentaureidin 5,7,3'-Trihydroxy-6,4'-dimethoxyflavone Demethoxycentaureidin 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
22934-99-2 |
| C_ID |
C00003891
, 
|
| InChIKey |
VCWFILUULGOFCD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-12-4-3-8(5-9(12)18)13-6-10(19)15-14(24-13)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica longifolia | Ref. |
| Plantae | Asteraceae | Baccharis gaudichaudiana | Ref. |
| Plantae | Asteraceae | Centaurea nigrescens | Ref. |
| Plantae | Asteraceae | Centaurea phrygia | Ref. |
| Plantae | Asteraceae | Haplopappus scrobiculatus | Ref. |
| Plantae | Labiatae | Sideritis spp. | Ref. |
| Plantae | Labiatae | Thymus satureioides | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
|
|
zoom in
| Organism | Centaurea nigrescens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Bohlmann,Tetrahedron Lett.,(1967),3239
Voirin,Planta Med.,(1985),523 |
|---|
|