| Name |
5,7,3',4'-Tetramethoxyflavone Luteolin 5,7,3',4'-tetramethyl ether |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
855-97-0 |
| C_ID |
C00003871
, 
|
| InChIKey |
CLXVBVLQKLQNRQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| SMILES |
COc1cc(OC)c2c(=O)cc(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bauhinia championii  | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Merrillia caloxylon | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Citrus reticulata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fraser,Phytochem.,13,(1974),1561
Phytochem.,22,(1983),625 |
|---|
|