| Name |
Scutevulin |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
80713-32-2 |
| C_ID |
C00003843
, 
|
| InChIKey |
XCBMYKIKEHGYAR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-15-12(20)6-10(18)14-11(19)7-13(22-16(14)15)8-4-2-3-5-9(8)17/h2-7,17-18,20H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)cc(-c3ccccc3O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria amabilis HARA | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
|
|
zoom in
| Organism | Scutellaria spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tomimori,Yakugaku Zasshi,104,(1984),529
Chou,Ann.Rep.Natl.Res.Inst.Chin.Med.,(1981),91 |
|---|
|
