| Name |
Stevioside |
| Formula |
C38H60O18 |
| Mw |
804.37796512 |
| CAS RN |
57817-89-7 |
| C_ID |
C00003485
, 
|
| InChIKey |
UEDUENGHJMELGK-YVOWDKJBNA-N |
| InChICode |
InChI=1S/C38H60O18/c1-16-11-37-9-5-20-35(2,7-4-8-36(20,3)34(50)55-32-29(49)26(46)23(43)18(13-40)52-32)21(37)6-10-38(16,15-37)56-33-30(27(47)24(44)19(14-41)53-33)54-31-28(48)25(45)22(42)17(12-39)51-31/h17-33,39-49H,1,4-15H2,2-3H3/t17-,18-,19-,20+,21+,22-,23-,24-,25+,26-,27+,28-,29-,30-,31+,32+,33+,35-,36-,37-,38+/m1/s1 |
| SMILES |
C=C1C[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O[C@@H]4OC(CO)[C@@H](O)C(O)C4O)[C@@H]2CC[C@]1(O[C@@H]1OC(CO)[C@@H](O)C(O)C1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium rebaudianum | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Rosaceae | Rubus suavissimus  | Ref. |
|
|
zoom in
| Organism | Rubus suavissimus | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|