| Name |
Spruceanol |
| Formula |
C20H28O2 |
| Mw |
300.20893014 |
| CAS RN |
72963-56-5 |
| C_ID |
C00003484
, 
|
| InChIKey |
KNSRUHGNXCWGHF-AXPCPNSHNA-N |
| InChICode |
InChI=1S/C20H28O2/c1-6-13-12(2)16(21)11-15-14(13)7-8-17-19(3,4)18(22)9-10-20(15,17)5/h6,11,17-18,21-22H,1,7-10H2,2-5H3/t17-,18-,20+/m1/s1 |
| SMILES |
C=Cc1c(C)c(O)cc2c1CC[C@@H]1C(C)(C)[C@H](O)CC[C@@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Jatropha divaricata | Ref. |
| Plantae | Euphorbiaceae | Micrandra spruceana | Ref. |
| - | - | family Euphorbiaceae spp. | Ref. |
|
|
zoom in
| Organism | family Euphorbiaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|