| Name |
Isodomedin |
| Formula |
C22H32O6 |
| Mw |
392.21988875 |
| CAS RN |
39388-61-9 |
| C_ID |
C00003442
, 
|
| InChIKey |
DHKJGTMHEVCMKJ-ZMMSFQDFNA-N |
| InChICode |
InChI=1S/C22H32O6/c1-10-12-6-7-13-21(5)14(8-16(25)22(13,18(10)26)19(12)27)20(3,4)17(9-15(21)24)28-11(2)23/h12-17,19,24-25,27H,1,6-9H2,2-5H3/t12-,13-,14+,15+,16+,17-,19+,21+,22-/m0/s1 |
| SMILES |
C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)[C@@H](OC(C)=O)C[C@@H](O)[C@@]4(C)[C@@H]2CC[C@@H]1[C@H]3O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Isodon pharicus | Ref. |
| Plantae | Labiatae | Isodon shikokianus var. intermedius | Ref. |
| Plantae | Labiatae | Isodon shikokuana var.intermedius | Ref. |
|
|
zoom in
| Organism | Isodon shikokuana var.intermedius |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Sun, et al., Diterpenoids from Isodon Species, Science Press, Beijing, (2001) |
|---|
|
