| Name |
Vernodalin |
| Formula |
C19H20O7 |
| Mw |
360.12090299 |
| CAS RN |
21871-10-3 |
| C_ID |
C00003384
, 
|
| InChIKey |
ZSXNBLOPYIJLQV-IIKQAUMUNA-N |
| InChICode |
InChI=1S/C19H20O7/c1-5-19-6-12(25-16(21)9(2)7-20)13-10(3)18(23)26-15(13)14(19)11(4)17(22)24-8-19/h5,12-15,20H,1-4,6-8H2/t12-,13+,14+,15-,19-/m0/s1 |
| SMILES |
C=C[C@@]12COC(=O)C(=C)[C@@H]1[C@H]1OC(=O)C(=C)[C@@H]1[C@@H](OC(=O)C(=C)CO)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Distephanus angulifolius | Ref. |
| Plantae | Asteraceae | Vernonia amygdalina  | Ref. |
| Plantae | Asteraceae | Vernonia esculenta | Ref. |
| Plantae | Asteraceae | Vernonia guineensis | Ref. |
|
|
zoom in
| Organism | Vernonia esculenta |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986) |
|---|
|
