| Name |
Warburganal |
| Formula |
C15H22O3 |
| Mw |
250.15689457 |
| CAS RN |
62994-47-2 |
| C_ID |
C00003202
, 
|
| InChIKey |
QGMWDUUHVVLHNP-FJBXCPOZNA-N |
| InChICode |
InChI=1S/C15H22O3/c1-13(2)7-4-8-14(3)12(13)6-5-11(9-16)15(14,18)10-17/h5,9-10,12,18H,4,6-8H2,1-3H3/t12-,14-,15+/m0/s1 |
| SMILES |
CC1(C)CCC[C@@]2(C)[C@H]1CC=C(C=O)[C@]2(O)C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Canellaceae | Warburgia salutaris  | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
| Plantae | Rubiaceae | Alberta magna | Ref. |
|
|
zoom in
| Organism | Stellaria pallida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|