| Name |
Camazulene Chamazulene |
| Formula |
C14H16 |
| Mw |
184.12520051 |
| CAS RN |
529-05-5 |
| C_ID |
C00003114
, 
|
| InChIKey |
GXGJIOMUZAGVEH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3 |
| SMILES |
CCc1ccc(C)c2ccc(C)c-2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea alpina | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Asteraceae | Achillea moschata | Ref. |
| Plantae | Asteraceae | Artemisia absinthium  | Ref. |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Chamomilla recutina | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Labiatae | Nepeta leucophylla | Ref. |
| Plantae | Lauraceae | Lindera strychnifolia  | Ref. |
| Plantae | Pinaceae | Pinus eldarica | Ref. |
| Plantae | Pinaceae | Pinus kochiana | Ref. |
| Plantae | Pinaceae | Pinus pallasiana | Ref. |
| Plantae | Pinaceae | Pinus sosnowskyi | Ref. |
| Plantae | Pinaceae | Pinus sylvestris L.var.sylvestris.  | Ref. |
| Plantae | Rutaceae | Skimmia laureola | Ref. |
| - | - | Achillea | Ref. |
| - | - | Achillea,Artemisia spp. | Ref. |
| - | - | Chamaemalum nobile | Ref. |
|
|
zoom in
| Organism | Achillea moschata | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|