| Name |
Betuloside Rhododendrin (-)-Rhododendrin |
| Formula |
C16H24O7 |
| Mw |
328.15220312 |
| CAS RN |
497-78-9 |
| C_ID |
C00003014
, 
|
| InChIKey |
KLLYDTMVSVIJEH-WFBUTOMWNA-N |
| InChICode |
InChI=1S/C16H24O7/c1-9(2-3-10-4-6-11(18)7-5-10)22-16-15(21)14(20)13(19)12(8-17)23-16/h4-7,9,12-21H,2-3,8H2,1H3/t9-,12-,13+,14-,15-,16+/m1/s1 |
| SMILES |
C[C@H](CCc1ccc(O)cc1)O[C@@H]1OC(CO)[C@@H](O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron chrysanthum | Ref. |
| Plantae | Ericaceae | Rhododendron fauriae | Ref. |
| Plantae | Ericaceae | Rhododendron fauriei | Ref. |
| Plantae | Ericaceae | Rhododendron ferrugineum  | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus canadensis | Ref. |
|
|
zoom in
| Organism | Rhododendron fauriei | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|