| Name |
Hypercalin B |
| Formula |
C33H42O5 |
| Mw |
518.30322445 |
| CAS RN |
125583-45-1 |
| C_ID |
C00002997
, 
|
| InChIKey |
NTCBJJMOLYDOIE-VLVMCLSINA-N |
| InChICode |
InChI=1S/C33H42O5/c1-20(2)13-17-33(18-14-21(3)4)30(36)25(19-26-24(22(5)6)15-16-32(26,7)38)29(35)27(31(33)37)28(34)23-11-9-8-10-12-23/h8-14,24,26,35-36,38H,5,15-19H2,1-4,6-7H3/t24-,26-,32+/m1/s1 |
| SMILES |
C=C(C)[C@H]1CC[C@](C)(O)[C@@H]1CC1=C(O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(C(=O)c2ccccc2)=C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Hypericaceae | Hypericum calycinum | Ref. |
| Plantae | Hypericaceae | Hypericum calycunum | Ref. |
|
|
zoom in
| Organism | Hypericum calycunum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|