| Name |
Tellimagrandin I |
| Formula |
C34H26O22 |
| Mw |
786.09157252 |
| CAS RN |
79786-08-6 |
| C_ID |
C00002938
, 
|
| InChIKey |
YKDNTEQLKGYZHT-ULLZYBDGNA-N |
| InChICode |
InChI=1S/C34H26O22/c35-12-1-8(2-13(36)21(12)41)30(47)55-28-27-18(53-34(51)29(28)56-31(48)9-3-14(37)22(42)15(38)4-9)7-52-32(49)10-5-16(39)23(43)25(45)19(10)20-11(33(50)54-27)6-17(40)24(44)26(20)46/h1-6,18,27-29,34-46,51H,7H2/t18-,27-,28+,29-,34-/m1/s1 |
| SMILES |
O=C(OC1C(O)OC2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@H]2[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Casuarinaceae | Casuarina rigida | Ref. |
| Plantae | Casuarinaceae | Casuarina stricta | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fagaceae | Quercus sp. | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrtaceae | Eucalyptus viminalis  | Ref. |
| Plantae | Myrtaceae | Feijoa sellowiana  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Onagraceae | Fuchsia spp. | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Rosaceae | Geum japonicum  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Saxifragaceae | Tellima grandiflora | Ref. |
| Plantae | Saxifragaceae | Tellima grandifolia | Ref. |
| Plantae | Stachyuraceae | Stachyurus praecox | Ref. |
| Plantae | Theaceae | Camellia japonica  | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|