| Name |
Rhaponticin
Rhaponthin
4'-Methoxy-3,3',5-trihydroxystilbene 3-O-beta-D-glucopyranoside |
| Formula |
C21H24O9 |
| Mw |
420.14203237 |
| CAS RN |
155-58-8 |
| C_ID |
C00002904
, 
|
| InChIKey |
GKAJCVFOJGXVIA-WJSKYKFWNA-N |
| InChICode |
InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18+,19-,20-,21+/m0/s1 |
| SMILES |
COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Guibourtia coleosperma | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
| Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum | Ref. |
| Plantae | Polygonaceae | Rheum altaicum | Ref. |
| Plantae | Polygonaceae | Rheum collineanum | Ref. |
| Plantae | Polygonaceae | Rheum cordatum | Ref. |
| Plantae | Polygonaceae | Rheum emodi | Ref. |
| Plantae | Polygonaceae | Rheum officinale | Ref. |
| Plantae | Polygonaceae | Rheum palmatum | Ref. |
| Plantae | Polygonaceae | Rheum rhaponticum | Ref. |
| Plantae | Polygonaceae | Rheum undulatum | Ref. |
|
|
zoom in
| Organism | Trigonella foenum-graecum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
