| Name |
4-Prenyldihydropinosylvin 3,5-Dihydroxy-4-(3-methyl-2-butenyl)bibenzyl |
| Formula |
C19H22O2 |
| Mw |
282.16197995 |
| CAS RN |
70610-11-6 |
| C_ID |
C00002899
, 
|
| InChIKey |
WRBJIPNZGJUCOJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H22O2/c1-14(2)8-11-17-18(20)12-16(13-19(17)21)10-9-15-6-4-3-5-7-15/h3-8,12-13,20-21H,9-11H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc(CCc2ccccc2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum umbraculigerum | Ref. |
| Plantae | Fabaceae | Glycyrrhiza lepidota  | Ref. |
| - | - | Radula buccinifera | Ref. |
| - | - | Radula complanata | Ref. |
|
|
zoom in
| Organism | Radula buccinifera | | Reference | Asakawa,Chemical constituents of Hepaticae, in Progress in the Chemistry of Organic Natural Products,Springer,Vienna,(1982),1 |
|---|
|