| Name |
3'-O-Methylbatatasin III |
| Formula |
C16H18O3 |
| Mw |
258.12559444 |
| CAS RN |
101330-69-2 |
| C_ID |
C00002891
, 
|
| InChIKey |
FDJURJXPMJANDW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H18O3/c1-18-15-5-3-4-12(9-15)6-7-13-8-14(17)11-16(10-13)19-2/h3-5,8-11,17H,6-7H2,1-2H3 |
| SMILES |
COc1cccc(CCc2cc(O)cc(OC)c2)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orchidaceae | Bletilla striata  | Ref. |
| Plantae | Orchidaceae | Coelogyne ovalis | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea | Ref. |
|
|
zoom in
| Organism | Gymnadenia conopsea | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Matsuda, et al., Planta Med, 70, (2004), 847 |
|---|
|