| Name |
Safrole |
| Formula |
C10H10O2 |
| Mw |
162.06807956 |
| CAS RN |
94-59-7 |
| C_ID |
C00002771
, 
|
| InChIKey |
ZMQAAUBTXCXRIC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H10O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2,4-6H,1,3,7H2 |
| SMILES |
C=CCc1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Aristolochiaceae | Asarum forbesii | Ref. |
| Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cupressaceae | Juniperus scopulorum  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Illiciaceae | Illicium religiosum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lauraceae | Aniba spp. | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Lindera neesiana  | Ref. |
| Plantae | Lauraceae | Ocotea pretiosa | Ref. |
| Plantae | Lauraceae | Sassafras albidum  | Ref. |
| Plantae | Magnoliaceae | Magnolia salicifolia  | Ref. |
| Plantae | Monimiaceae | Nemuaron humboldtii | Ref. |
| Plantae | Myoporaceae | Eremophila longifolia  | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Asarum forbesii | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|