| Name |
Otobain |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
3738-01-0 |
| C_ID |
C00002614
, 
|
| InChIKey |
AZCUKURZKHRDTN-DQSKLBNHNA-N |
| InChICode |
InChI=1S/C20H20O4/c1-11-7-12(2)18(13-3-5-15-17(8-13)23-9-21-15)19-14(11)4-6-16-20(19)24-10-22-16/h3-6,8,11-12,18H,7,9-10H2,1-2H3/t11-,12-,18-/m1/s1 |
| SMILES |
C[C@@H]1C[C@@H](C)[C@H](c2ccc3c(c2)OCO3)c2c1ccc1c2OCO1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Myristicaceae | Myristica otoba | Ref. |
| Plantae | Myristicaceae | Myristica simarum | Ref. |
| Plantae | Myristicaceae | Myristica simiarum | Ref. |
|
|
zoom in
| Organism | Myristica simiarum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|