| Name |
Grandisin (-)-Grandisin |
| Formula |
C24H32O7 |
| Mw |
432.21480338 |
| CAS RN |
53250-50-3 |
| C_ID |
C00002607
, 
|
| InChIKey |
ZPINJJOPURFFNV-XCWNSANENA-N |
| InChICode |
InChI=1S/C24H32O7/c1-13-14(2)22(16-11-19(27-5)24(30-8)20(12-16)28-6)31-21(13)15-9-17(25-3)23(29-7)18(10-15)26-4/h9-14,21-22H,1-8H3/t13-,14-,21-,22-/m0/s1 |
| SMILES |
COc1cc([C@H]2O[C@H](c3cc(OC)c(OC)c(OC)c3)[C@@H](C)[C@@H]2C)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Rhaphidophora decursiva  | Ref. |
| Plantae | Lauraceae | Cryptocarya crassinervia | Ref. |
| Plantae | Lauraceae | Litsea grandis | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Meliaceae | Aglaia leptantha  | Ref. |
| Plantae | Myristicaceae | Virola surinamensis  | Ref. |
| Plantae | Piperaceae | Piper polysyphorum | Ref. |
| Plantae | Piperaceae | Piper solmsianum | Ref. |
| Plantae | Schisandraceae | Kadsura longipedunculata | Ref. |
|
|
zoom in
| Organism | Litsea grandis | | Reference | Martins, et al., Phytochemistry, 64, (2003), 667.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter39 |
|---|
|