| Name |
Wedelolactone 1,8,9-Trihydroxy-3-methoxycoumestan 5,11,12-Trihydroxy-7-methoxycoumestan |
| Formula |
C16H10O7 |
| Mw |
314.04265268 |
| CAS RN |
524-12-9 |
| C_ID |
C00002585
, 
|
| InChIKey |
XQDCKJKKMFWXGB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
| SMILES |
COc1cc(O)c2c(c1)oc(=O)c1c3cc(O)c(O)cc3oc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eclipta alba  | Ref. |
| Plantae | Asteraceae | Wedelia calendulacea  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Fabaceae | Ougeinia dalbergioides  | Ref. |
|
|
zoom in
| Organism | Thuja orientalis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|